About 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate
2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate (PubChem CID 143793220) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate |
| PubChem CID | 143793220 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate |
| SMILES | CC(C)COC(=O)C(C#N)n1cccc1 |
| InChI | InChI=1S/C11H14N2O2/c1-9(2)8-15-11(14)10(7-12)13-5-3-4-6-13/h3-6,9-10H,8H2,1-2H3 |
| InChIKey | RTJWBRYXPDWJSY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate?
The IUPAC name of 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate (CID 143793220) is 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate.
What is the SMILES notation for 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate?
The canonical SMILES for 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate is CC(C)COC(=O)C(C#N)n1cccc1.
What is the InChIKey of 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate?
The InChIKey is RTJWBRYXPDWJSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-9(2)8-15-11(14)10(7-12)13-5-3-4-6-13/h3-6,9-10H,8H2,1-2H3.
What are the key properties of 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate?
2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate has a molecular weight of 206.25 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-cyano-2-pyrrol-1-ylacetate is sourced from PubChem (CID 143793220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).