About 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane
2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane (PubChem CID 143793858) has the molecular formula C29H38O
and a molecular weight of 402.62 g/mol. Its IUPAC name is 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane.
Molecular Properties
| Compound Name | 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane |
| PubChem CID | 143793858 |
| Molecular Formula | C29H38O |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane |
| SMILES | CCC.Cc1c(-c2ccc(-c3ccc(C(C)(C)O)cc3)cc2)ccc(C(C)C)c1C |
| InChI | InChI=1S/C26H30O.C3H8/c1-17(2)24-15-16-25(19(4)18(24)3)22-9-7-20(8-10-22)21-11-13-23(14-12-21)26(5,6)27;1-3-2/h7-17,27H,1-6H3;3H2,1-2H3 |
| InChIKey | MDCXJMLNPLCROC-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane?
The IUPAC name of 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane (CID 143793858) is 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane.
What is the SMILES notation for 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane?
The canonical SMILES for 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane is CCC.Cc1c(-c2ccc(-c3ccc(C(C)(C)O)cc3)cc2)ccc(C(C)C)c1C.
What is the InChIKey of 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane?
The InChIKey is MDCXJMLNPLCROC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30O.C3H8/c1-17(2)24-15-16-25(19(4)18(24)3)22-9-7-20(8-10-22)21-11-13-23(14-12-21)26(5,6)27;1-3-2/h7-17,27H,1-6H3;3H2,1-2H3.
What are the key properties of 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane?
2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane has a molecular weight of 402.62 g/mol, XLogP of 8.40, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(2,3-dimethyl-4-propan-2-ylphenyl)phenyl]phenyl]propan-2-ol;propane is sourced from PubChem (CID 143793858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).