About N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine
N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine (PubChem CID 143793924) has the molecular formula C22H25F6N
and a molecular weight of 417.44 g/mol. Its IUPAC name is N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine.
Molecular Properties
| Compound Name | N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine |
| PubChem CID | 143793924 |
| Molecular Formula | C22H25F6N |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine |
| SMILES | CC(CCN(Cc1ccccc1)C(C)C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F6N/c1-15(2)29(14-17-7-5-4-6-8-17)10-9-16(3)18-11-19(21(23,24)25)13-20(12-18)22(26,27)28/h4-8,11-13,15-16H,9-10,14H2,1-3H3 |
| InChIKey | BXJXYDHTJAHODO-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine?
The IUPAC name of N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine (CID 143793924) is N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine.
What is the SMILES notation for N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine?
The canonical SMILES for N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine is CC(CCN(Cc1ccccc1)C(C)C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine?
The InChIKey is BXJXYDHTJAHODO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F6N/c1-15(2)29(14-17-7-5-4-6-8-17)10-9-16(3)18-11-19(21(23,24)25)13-20(12-18)22(26,27)28/h4-8,11-13,15-16H,9-10,14H2,1-3H3.
What are the key properties of N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine?
N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine has a molecular weight of 417.44 g/mol, XLogP of 7.13, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]-N-propan-2-ylbutan-1-amine is sourced from PubChem (CID 143793924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).