C18H15F4N3 — CID 143794091
1-(3-fluorophenyl)-N-[[1-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]methanamine (PubChem CID 143794091) has the molecular formula C18H15F4N3 and a molecular weight of 349.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[[1-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]methanamine.
| Compound Name | 1-(3-fluorophenyl)-N-[[1-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]methanamine |
|---|---|
| PubChem CID | 143794091 |
| Molecular Formula | C18H15F4N3 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[[1-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]methanamine |
| SMILES | Fc1cccc(CNCc2ccn(-c3ccc(C(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C18H15F4N3/c19-15-3-1-2-13(10-15)11-23-12-16-8-9-25(24-16)17-6-4-14(5-7-17)18(20,21)22/h1-10,23H,11-12H2 |
| InChIKey | ITPNHEUMWLSFPM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |