About CID 143794364
CID 143794364 (PubChem CID 143794364) has the molecular formula C17H16B3F3N2O2P
and a molecular weight of 400.73 g/mol.
Molecular Properties
| Compound Name | CID 143794364 |
| PubChem CID | 143794364 |
| Molecular Formula | C17H16B3F3N2O2P |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | — |
| SMILES | C=C(F)/C=C\C([B]OB(OB(P)c1ccc(F)nc1)c1ccc(F)nc1)=C/C |
| InChI | InChI=1S/C17H16B3F3N2O2P/c1-3-13(5-4-12(2)21)18-26-19(14-6-8-16(22)24-10-14)27-20(28)15-7-9-17(23)25-11-15/h3-11H,2,28H2,1H3/b5-4-,13-3+ |
| InChIKey | KGOKATGSVZEXAE-BNXXKACXSA-N |
| XLogP | 2.32 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 143794364 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143794364?
The IUPAC name of CID 143794364 (CID 143794364) is not available.
What is the SMILES notation for CID 143794364?
The canonical SMILES for CID 143794364 is C=C(F)/C=C\C([B]OB(OB(P)c1ccc(F)nc1)c1ccc(F)nc1)=C/C.
What is the InChIKey of CID 143794364?
The InChIKey is KGOKATGSVZEXAE-BNXXKACXSA-N. The full InChI is InChI=1S/C17H16B3F3N2O2P/c1-3-13(5-4-12(2)21)18-26-19(14-6-8-16(22)24-10-14)27-20(28)15-7-9-17(23)25-11-15/h3-11H,2,28H2,1H3/b5-4-,13-3+.
What are the key properties of CID 143794364?
CID 143794364 has a molecular weight of 400.73 g/mol, XLogP of 2.32, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143794364 is sourced from PubChem (CID 143794364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).