About 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline
2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline (PubChem CID 143794435) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline.
Molecular Properties
| Compound Name | 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline |
| PubChem CID | 143794435 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline |
| SMILES | CC1CCCN1.Cc1cc(N2CCCC2)ccc1N |
| InChI | InChI=1S/C11H16N2.C5H11N/c1-9-8-10(4-5-11(9)12)13-6-2-3-7-13;1-5-3-2-4-6-5/h4-5,8H,2-3,6-7,12H2,1H3;5-6H,2-4H2,1H3 |
| InChIKey | FIEPITYITNTCLC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline?
The IUPAC name of 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline (CID 143794435) is 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline.
What is the SMILES notation for 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline?
The canonical SMILES for 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline is CC1CCCN1.Cc1cc(N2CCCC2)ccc1N.
What is the InChIKey of 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline?
The InChIKey is FIEPITYITNTCLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.C5H11N/c1-9-8-10(4-5-11(9)12)13-6-2-3-7-13;1-5-3-2-4-6-5/h4-5,8H,2-3,6-7,12H2,1H3;5-6H,2-4H2,1H3.
What are the key properties of 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline?
2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline has a molecular weight of 261.41 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrrolidine;2-methyl-4-pyrrolidin-1-ylaniline is sourced from PubChem (CID 143794435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).