About chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol
chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol (PubChem CID 143796164) has the molecular formula C24H22ClFN4O
and a molecular weight of 436.92 g/mol. Its IUPAC name is chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol.
Molecular Properties
| Compound Name | chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol |
| PubChem CID | 143796164 |
| Molecular Formula | C24H22ClFN4O |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol |
| SMILES | Clc1ccccc1.Oc1ccc(F)cc1-c1nc(NC2CCNC2)c2ccccc2n1 |
| InChI | InChI=1S/C18H17FN4O.C6H5Cl/c19-11-5-6-16(24)14(9-11)18-22-15-4-2-1-3-13(15)17(23-18)21-12-7-8-20-10-12;7-6-4-2-1-3-5-6/h1-6,9,12,20,24H,7-8,10H2,(H,21,22,23);1-5H |
| InChIKey | OTLMRSNGPJYION-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol?
The IUPAC name of chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol (CID 143796164) is chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol.
What is the SMILES notation for chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol?
The canonical SMILES for chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol is Clc1ccccc1.Oc1ccc(F)cc1-c1nc(NC2CCNC2)c2ccccc2n1.
What is the InChIKey of chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol?
The InChIKey is OTLMRSNGPJYION-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN4O.C6H5Cl/c19-11-5-6-16(24)14(9-11)18-22-15-4-2-1-3-13(15)17(23-18)21-12-7-8-20-10-12;7-6-4-2-1-3-5-6/h1-6,9,12,20,24H,7-8,10H2,(H,21,22,23);1-5H.
What are the key properties of chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol?
chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol has a molecular weight of 436.92 g/mol, XLogP of 5.26, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;4-fluoro-2-[4-(pyrrolidin-3-ylamino)quinazolin-2-yl]phenol is sourced from PubChem (CID 143796164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).