About 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene
4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene (PubChem CID 143796192) has the molecular formula C25H25ClN4O
and a molecular weight of 432.96 g/mol. Its IUPAC name is 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene.
Molecular Properties
| Compound Name | 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene |
| PubChem CID | 143796192 |
| Molecular Formula | C25H25ClN4O |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene |
| SMILES | Cc1ccccc1.Oc1ccc(Cl)cc1-c1nc(N[C@H]2CCNC2)c2ccccc2n1 |
| InChI | InChI=1S/C18H17ClN4O.C7H8/c19-11-5-6-16(24)14(9-11)18-22-15-4-2-1-3-13(15)17(23-18)21-12-7-8-20-10-12;1-7-5-3-2-4-6-7/h1-6,9,12,20,24H,7-8,10H2,(H,21,22,23);2-6H,1H3/t12-;/m0./s1 |
| InChIKey | XJNLORNCXWBPGJ-YDALLXLXSA-N |
| XLogP | 5.42 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene?
The IUPAC name of 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene (CID 143796192) is 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene.
What is the SMILES notation for 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene?
The canonical SMILES for 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene is Cc1ccccc1.Oc1ccc(Cl)cc1-c1nc(N[C@H]2CCNC2)c2ccccc2n1.
What is the InChIKey of 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene?
The InChIKey is XJNLORNCXWBPGJ-YDALLXLXSA-N. The full InChI is InChI=1S/C18H17ClN4O.C7H8/c19-11-5-6-16(24)14(9-11)18-22-15-4-2-1-3-13(15)17(23-18)21-12-7-8-20-10-12;1-7-5-3-2-4-6-7/h1-6,9,12,20,24H,7-8,10H2,(H,21,22,23);2-6H,1H3/t12-;/m0./s1.
What are the key properties of 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene?
4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene has a molecular weight of 432.96 g/mol, XLogP of 5.42, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[4-[[(3S)-pyrrolidin-3-yl]amino]quinazolin-2-yl]phenol;toluene is sourced from PubChem (CID 143796192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).