C9H14O2 — CID 14379675
4-hydroxy-5,7-dimethylcyclohept-2-en-1-one (PubChem CID 14379675) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 4-hydroxy-5,7-dimethylcyclohept-2-en-1-one.
| Compound Name | 4-hydroxy-5,7-dimethylcyclohept-2-en-1-one |
|---|---|
| PubChem CID | 14379675 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 4-hydroxy-5,7-dimethylcyclohept-2-en-1-one |
| SMILES | CC1CC(C)C(O)C=CC1=O |
| InChI | InChI=1S/C9H14O2/c1-6-5-7(2)9(11)4-3-8(6)10/h3-4,6-8,10H,5H2,1-2H3 |
| InChIKey | DWHVCVBMKVKTKY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |