C21H34F3N3OS — CID 143796796
N-ethylsulfanyl-4-methylcyclohexan-1-amine;N-methyl-3-morpholin-4-yl-4-(trifluoromethyl)aniline (PubChem CID 143796796) has the molecular formula C21H34F3N3OS and a molecular weight of 433.58 g/mol. Its IUPAC name is N-ethylsulfanyl-4-methylcyclohexan-1-amine;N-methyl-3-morpholin-4-yl-4-(trifluoromethyl)aniline.
| Compound Name | N-ethylsulfanyl-4-methylcyclohexan-1-amine;N-methyl-3-morpholin-4-yl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 143796796 |
| Molecular Formula | C21H34F3N3OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-ethylsulfanyl-4-methylcyclohexan-1-amine;N-methyl-3-morpholin-4-yl-4-(trifluoromethyl)aniline |
| SMILES | CCSNC1CCC(C)CC1.CNc1ccc(C(F)(F)F)c(N2CCOCC2)c1 |
| InChI | InChI=1S/C12H15F3N2O.C9H19NS/c1-16-9-2-3-10(12(13,14)15)11(8-9)17-4-6-18-7-5-17;1-3-11-10-9-6-4-8(2)5-7-9/h2-3,8,16H,4-7H2,1H3;8-10H,3-7H2,1-2H3 |
| InChIKey | ZZIQQCXOWDQUQC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|