About 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole
2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole (PubChem CID 143796887) has the molecular formula C13H15FN4O2
and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole |
| PubChem CID | 143796887 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole |
| SMILES | Cc1coc(N2CC[C@@H](Oc3ncccn3)[C@@H](F)C2)n1 |
| InChI | InChI=1S/C13H15FN4O2/c1-9-8-19-13(17-9)18-6-3-11(10(14)7-18)20-12-15-4-2-5-16-12/h2,4-5,8,10-11H,3,6-7H2,1H3/t10-,11+/m0/s1 |
| InChIKey | UWBIFYZRYFNKHG-WDEREUQCSA-N |
| XLogP | 1.77 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole?
The IUPAC name of 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole (CID 143796887) is 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole.
What is the SMILES notation for 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole?
The canonical SMILES for 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole is Cc1coc(N2CC[C@@H](Oc3ncccn3)[C@@H](F)C2)n1.
What is the InChIKey of 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole?
The InChIKey is UWBIFYZRYFNKHG-WDEREUQCSA-N. The full InChI is InChI=1S/C13H15FN4O2/c1-9-8-19-13(17-9)18-6-3-11(10(14)7-18)20-12-15-4-2-5-16-12/h2,4-5,8,10-11H,3,6-7H2,1H3/t10-,11+/m0/s1.
What are the key properties of 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole?
2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole has a molecular weight of 278.29 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-3-fluoro-4-pyrimidin-2-yloxypiperidin-1-yl]-4-methyl-1,3-oxazole is sourced from PubChem (CID 143796887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).