About tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane
tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane (PubChem CID 143797454) has the molecular formula C15H29NO4
and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane |
| PubChem CID | 143797454 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane |
| SMILES | CC.CC1CCC(C(=O)CO)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H23NO4.C2H6/c1-9-5-6-10(11(16)8-15)14(7-9)12(17)18-13(2,3)4;1-2/h9-10,15H,5-8H2,1-4H3;1-2H3 |
| InChIKey | GRZJGLMXRSVSLI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane?
The IUPAC name of tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane (CID 143797454) is tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane.
What is the SMILES notation for tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane?
The canonical SMILES for tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane is CC.CC1CCC(C(=O)CO)N(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane?
The InChIKey is GRZJGLMXRSVSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4.C2H6/c1-9-5-6-10(11(16)8-15)14(7-9)12(17)18-13(2,3)4;1-2/h9-10,15H,5-8H2,1-4H3;1-2H3.
What are the key properties of tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane?
tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane has a molecular weight of 287.40 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(2-hydroxyacetyl)-5-methylpiperidine-1-carboxylate;ethane is sourced from PubChem (CID 143797454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).