C22H34O4 — CID 14379773
[(3aR,3bR,4R,5aS,9aS,9bR,11aR)-3b,6,6,9a-tetramethyl-1-oxo-3,3a,4,5,5a,7,8,9,9b,10,11,11a-dodecahydronaphtho[2,1-e][2]benzofuran-4-yl] acetate (PubChem CID 14379773) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(3aR,3bR,4R,5aS,9aS,9bR,11aR)-3b,6,6,9a-tetramethyl-1-oxo-3,3a,4,5,5a,7,8,9,9b,10,11,11a-dodecahydronaphtho[2,1-e][2]benzofuran-4-yl] acetate.
| Compound Name | [(3aR,3bR,4R,5aS,9aS,9bR,11aR)-3b,6,6,9a-tetramethyl-1-oxo-3,3a,4,5,5a,7,8,9,9b,10,11,11a-dodecahydronaphtho[2,1-e][2]benzofuran-4-yl] acetate |
|---|---|
| PubChem CID | 14379773 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(3aR,3bR,4R,5aS,9aS,9bR,11aR)-3b,6,6,9a-tetramethyl-1-oxo-3,3a,4,5,5a,7,8,9,9b,10,11,11a-dodecahydronaphtho[2,1-e][2]benzofuran-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2C(C)(C)CCC[C@]2(C)[C@H]2CC[C@H]3C(=O)OC[C@H]3[C@@]21C |
| InChI | InChI=1S/C22H34O4/c1-13(23)26-18-11-17-20(2,3)9-6-10-21(17,4)16-8-7-14-15(22(16,18)5)12-25-19(14)24/h14-18H,6-12H2,1-5H3/t14-,15-,16-,17+,18-,21-,22+/m1/s1 |
| InChIKey | SPWYWLLHMLQUGG-RMGCFARWSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |