About (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane
(2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane (PubChem CID 14379832) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane.
Molecular Properties
| Compound Name | (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane |
| PubChem CID | 14379832 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane |
| SMILES | C=C(C)/C=C/[C@H]1C[C@@H](C)CO1 |
| InChI | InChI=1S/C10H16O/c1-8(2)4-5-10-6-9(3)7-11-10/h4-5,9-10H,1,6-7H2,2-3H3/b5-4+/t9-,10+/m1/s1 |
| InChIKey | SULWOTZUSYCRIP-CFUOYWMPSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane?
The IUPAC name of (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane (CID 14379832) is (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane.
What is the SMILES notation for (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane?
The canonical SMILES for (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane is C=C(C)/C=C/[C@H]1C[C@@H](C)CO1.
What is the InChIKey of (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane?
The InChIKey is SULWOTZUSYCRIP-CFUOYWMPSA-N. The full InChI is InChI=1S/C10H16O/c1-8(2)4-5-10-6-9(3)7-11-10/h4-5,9-10H,1,6-7H2,2-3H3/b5-4+/t9-,10+/m1/s1.
What are the key properties of (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane?
(2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane has a molecular weight of 152.24 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxolane is sourced from PubChem (CID 14379832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).