C24H24ClF3N2O — CID 143798803
1-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3,3-difluoro-2-(4-fluorophenyl)hex-5-en-2-ol (PubChem CID 143798803) has the molecular formula C24H24ClF3N2O and a molecular weight of 448.92 g/mol. Its IUPAC name is 1-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3,3-difluoro-2-(4-fluorophenyl)hex-5-en-2-ol.
| Compound Name | 1-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3,3-difluoro-2-(4-fluorophenyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 143798803 |
| Molecular Formula | C24H24ClF3N2O |
| Molecular Weight | 448.92 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3,3-difluoro-2-(4-fluorophenyl)hex-5-en-2-ol |
| SMILES | C=CCC(F)(F)C(O)(Cn1c2c(c3cc(Cl)ccc31)CN(C)CC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24ClF3N2O/c1-3-11-24(27,28)23(31,16-4-7-18(26)8-5-16)15-30-21-9-6-17(25)13-19(21)20-14-29(2)12-10-22(20)30/h3-9,13,31H,1,10-12,14-15H2,2H3 |
| InChIKey | DXNCZYWQDNJAMO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.92 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|