C23H36N6O2 — CID 143799816
cis-(2R,6S)-1,1,2,3,6-pentamethylcyclohexane;2-(4,5-diamino-6-oxopyridazin-1-yl)-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 143799816) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is cis-(2R,6S)-1,1,2,3,6-pentamethylcyclohexane;2-(4,5-diamino-6-oxopyridazin-1-yl)-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | cis-(2R,6S)-1,1,2,3,6-pentamethylcyclohexane;2-(4,5-diamino-6-oxopyridazin-1-yl)-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 143799816 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | cis-(2R,6S)-1,1,2,3,6-pentamethylcyclohexane;2-(4,5-diamino-6-oxopyridazin-1-yl)-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | CC1CC[C@H](C)C(C)(C)[C@@H]1C.Nc1cnn(CC(=O)NCc2ccncc2)c(=O)c1N |
| InChI | InChI=1S/C12H14N6O2.C11H22/c13-9-6-17-18(12(20)11(9)14)7-10(19)16-5-8-1-3-15-4-2-8;1-8-6-7-9(2)11(4,5)10(8)3/h1-4,6H,5,7,13-14H2,(H,16,19);8-10H,6-7H2,1-5H3/t;8?,9-,10+/m.0/s1 |
| InChIKey | IPGCXGFQGCLDKN-DHAPRHKASA-N |
| XLogP | 2.83 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |