C35H51N3O2 — CID 143800134
5-[3-(3-aminopropyl)phenyl]-N,N-dimethylpentanamide;(1R)-3-[3-(3-aminopropyl)phenyl]-1-(4-methylphenyl)propan-1-ol (PubChem CID 143800134) has the molecular formula C35H51N3O2 and a molecular weight of 545.81 g/mol. Its IUPAC name is 5-[3-(3-aminopropyl)phenyl]-N,N-dimethylpentanamide;(1R)-3-[3-(3-aminopropyl)phenyl]-1-(4-methylphenyl)propan-1-ol.
| Compound Name | 5-[3-(3-aminopropyl)phenyl]-N,N-dimethylpentanamide;(1R)-3-[3-(3-aminopropyl)phenyl]-1-(4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 143800134 |
| Molecular Formula | C35H51N3O2 |
| Molecular Weight | 545.81 g/mol |
| Exact Mass | 545.40 |
| IUPAC Name | 5-[3-(3-aminopropyl)phenyl]-N,N-dimethylpentanamide;(1R)-3-[3-(3-aminopropyl)phenyl]-1-(4-methylphenyl)propan-1-ol |
| SMILES | CN(C)C(=O)CCCCc1cccc(CCCN)c1.Cc1ccc([C@H](O)CCc2cccc(CCCN)c2)cc1 |
| InChI | InChI=1S/C19H25NO.C16H26N2O/c1-15-7-10-18(11-8-15)19(21)12-9-17-5-2-4-16(14-17)6-3-13-20;1-18(2)16(19)11-4-3-7-14-8-5-9-15(13-14)10-6-12-17/h2,4-5,7-8,10-11,14,19,21H,3,6,9,12-13,20H2,1H3;5,8-9,13H,3-4,6-7,10-12,17H2,1-2H3/t19-;/m1./s1 |
| InChIKey | JWRTXIIVHCKOLW-FSRHSHDFSA-N |
| XLogP | 5.93 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|