C17H30N6O5 — CID 143800276
3-[2-[[(3Z)-3-amino-3-hydroxyiminopropoxy]methyl]-3-(2-cyanoethoxy)-2-(2-cyanoethoxymethyl)propoxy]propanimidamide (PubChem CID 143800276) has the molecular formula C17H30N6O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-[2-[[(3Z)-3-amino-3-hydroxyiminopropoxy]methyl]-3-(2-cyanoethoxy)-2-(2-cyanoethoxymethyl)propoxy]propanimidamide.
| Compound Name | 3-[2-[[(3Z)-3-amino-3-hydroxyiminopropoxy]methyl]-3-(2-cyanoethoxy)-2-(2-cyanoethoxymethyl)propoxy]propanimidamide |
|---|---|
| PubChem CID | 143800276 |
| Molecular Formula | C17H30N6O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 3-[2-[[(3Z)-3-amino-3-hydroxyiminopropoxy]methyl]-3-(2-cyanoethoxy)-2-(2-cyanoethoxymethyl)propoxy]propanimidamide |
| SMILES | [H]/N=C(\N)CCOCC(COCCC#N)(COCCC#N)COCC/C(N)=N/O |
| InChI | InChI=1S/C17H30N6O5/c18-5-1-7-25-11-17(12-26-8-2-6-19,13-27-9-3-15(20)21)14-28-10-4-16(22)23-24/h24H,1-4,7-14H2,(H3,20,21)(H2,22,23) |
| InChIKey | GBRZGCPYTCDILI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 192.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|