C24H34N6O6 — CID 143800330
3-[(2S,3R,4R,5R)-2,3,4,5-tetrakis(2-cyanoethoxy)-6-(3-iminopropoxy)hexoxy]propanenitrile (PubChem CID 143800330) has the molecular formula C24H34N6O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5R)-2,3,4,5-tetrakis(2-cyanoethoxy)-6-(3-iminopropoxy)hexoxy]propanenitrile.
| Compound Name | 3-[(2S,3R,4R,5R)-2,3,4,5-tetrakis(2-cyanoethoxy)-6-(3-iminopropoxy)hexoxy]propanenitrile |
|---|---|
| PubChem CID | 143800330 |
| Molecular Formula | C24H34N6O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 3-[(2S,3R,4R,5R)-2,3,4,5-tetrakis(2-cyanoethoxy)-6-(3-iminopropoxy)hexoxy]propanenitrile |
| SMILES | [H]/N=C/CCOC[C@@H](OCCC#N)[C@@H](OCCC#N)[C@H](OCCC#N)[C@H](COCCC#N)OCCC#N |
| InChI | InChI=1S/C24H34N6O6/c25-7-1-13-31-19-21(33-15-3-9-27)23(35-17-5-11-29)24(36-18-6-12-30)22(34-16-4-10-28)20-32-14-2-8-26/h7,21-25H,1-6,13-20H2/b25-7+/t21-,22+,23-,24-/m1/s1 |
| InChIKey | AFDPOZOXNJGPAH-KCHKOUBLSA-N |
| XLogP | 2.17 |
| TPSA | 198.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|