C10H20FN — CID 143800416
ethane;N-[(2E)-3-fluoropenta-2,4-dien-2-yl]methanimine (PubChem CID 143800416) has the molecular formula C10H20FN and a molecular weight of 173.27 g/mol. Its IUPAC name is ethane;N-[(2E)-3-fluoropenta-2,4-dien-2-yl]methanimine.
| Compound Name | ethane;N-[(2E)-3-fluoropenta-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 143800416 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | ethane;N-[(2E)-3-fluoropenta-2,4-dien-2-yl]methanimine |
| SMILES | C=C/C(F)=C(/C)N=C.CC.CC |
| InChI | InChI=1S/C6H8FN.2C2H6/c1-4-6(7)5(2)8-3;2*1-2/h4H,1,3H2,2H3;2*1-2H3/b6-5+;; |
| InChIKey | OVMYHTRVFBMRLJ-TXOOBNKBSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|