About N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine
N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine (PubChem CID 143800481) has the molecular formula C8H14FNO
and a molecular weight of 159.20 g/mol. Its IUPAC name is N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine |
| PubChem CID | 143800481 |
| Molecular Formula | C8H14FNO |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine |
| SMILES | CC(C)C/C=C\C(F)=C/NO |
| InChI | InChI=1S/C8H14FNO/c1-7(2)4-3-5-8(9)6-10-11/h3,5-7,10-11H,4H2,1-2H3/b5-3-,8-6+ |
| InChIKey | BGIPSLPLSHHMFC-CUKJDEOPSA-N |
| XLogP | 2.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine?
The IUPAC name of N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine (CID 143800481) is N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine.
What is the SMILES notation for N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine?
The canonical SMILES for N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine is CC(C)C/C=C\C(F)=C/NO.
What is the InChIKey of N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine?
The InChIKey is BGIPSLPLSHHMFC-CUKJDEOPSA-N. The full InChI is InChI=1S/C8H14FNO/c1-7(2)4-3-5-8(9)6-10-11/h3,5-7,10-11H,4H2,1-2H3/b5-3-,8-6+.
What are the key properties of N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine?
N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine has a molecular weight of 159.20 g/mol, XLogP of 2.38, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E,3Z)-2-fluoro-6-methylhepta-1,3-dienyl]hydroxylamine is sourced from PubChem (CID 143800481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).