About (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine
(2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine (PubChem CID 143800580) has the molecular formula C9H13F3N2
and a molecular weight of 206.21 g/mol. Its IUPAC name is (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine.
Molecular Properties
| Compound Name | (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine |
| PubChem CID | 143800580 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine |
| SMILES | C=C/C(=C\N=C(/C)C(F)(F)F)CNC |
| InChI | InChI=1S/C9H13F3N2/c1-4-8(5-13-3)6-14-7(2)9(10,11)12/h4,6,13H,1,5H2,2-3H3/b8-6+,14-7+ |
| InChIKey | YHBSYDGQWNMXBV-LEYKSEKISA-N |
| XLogP | 2.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine?
The IUPAC name of (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine (CID 143800580) is (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine.
What is the SMILES notation for (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine?
The canonical SMILES for (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine is C=C/C(=C\N=C(/C)C(F)(F)F)CNC.
What is the InChIKey of (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine?
The InChIKey is YHBSYDGQWNMXBV-LEYKSEKISA-N. The full InChI is InChI=1S/C9H13F3N2/c1-4-8(5-13-3)6-14-7(2)9(10,11)12/h4,6,13H,1,5H2,2-3H3/b8-6+,14-7+.
What are the key properties of (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine?
(2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine has a molecular weight of 206.21 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-methyl-2-[(1,1,1-trifluoropropan-2-ylideneamino)methylidene]but-3-en-1-amine is sourced from PubChem (CID 143800580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).