About ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene
ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene (PubChem CID 143800942) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene.
Molecular Properties
| Compound Name | ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene |
| PubChem CID | 143800942 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene |
| SMILES | C/C=C/Oc1cccc(C)c1.C=CC.CC |
| InChI | InChI=1S/C10H12O.C3H6.C2H6/c1-3-7-11-10-6-4-5-9(2)8-10;1-3-2;1-2/h3-8H,1-2H3;3H,1H2,2H3;1-2H3/b7-3+;; |
| InChIKey | ZEKRNDFFKJLNRD-BABLKGGBSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene?
The IUPAC name of ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene (CID 143800942) is ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene.
What is the SMILES notation for ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene?
The canonical SMILES for ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene is C/C=C/Oc1cccc(C)c1.C=CC.CC.
What is the InChIKey of ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene?
The InChIKey is ZEKRNDFFKJLNRD-BABLKGGBSA-N. The full InChI is InChI=1S/C10H12O.C3H6.C2H6/c1-3-7-11-10-6-4-5-9(2)8-10;1-3-2;1-2/h3-8H,1-2H3;3H,1H2,2H3;1-2H3/b7-3+;;.
What are the key properties of ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene?
ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene has a molecular weight of 220.36 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3-[(E)-prop-1-enoxy]benzene;prop-1-ene is sourced from PubChem (CID 143800942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).