About methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde
methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde (PubChem CID 143801247) has the molecular formula C10H12F3NO
and a molecular weight of 219.21 g/mol. Its IUPAC name is methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde.
Molecular Properties
| Compound Name | methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde |
| PubChem CID | 143801247 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde |
| SMILES | CN.Cc1ccc(C(F)(F)F)c(C=O)c1 |
| InChI | InChI=1S/C9H7F3O.CH5N/c1-6-2-3-8(9(10,11)12)7(4-6)5-13;1-2/h2-5H,1H3;2H2,1H3 |
| InChIKey | JYUIWGZVNNCHEH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde?
The IUPAC name of methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde (CID 143801247) is methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde.
What is the SMILES notation for methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde?
The canonical SMILES for methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde is CN.Cc1ccc(C(F)(F)F)c(C=O)c1.
What is the InChIKey of methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde?
The InChIKey is JYUIWGZVNNCHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O.CH5N/c1-6-2-3-8(9(10,11)12)7(4-6)5-13;1-2/h2-5H,1H3;2H2,1H3.
What are the key properties of methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde?
methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde has a molecular weight of 219.21 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;5-methyl-2-(trifluoromethyl)benzaldehyde is sourced from PubChem (CID 143801247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).