About 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole
3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole (PubChem CID 143801548) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole.
Molecular Properties
| Compound Name | 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole |
| PubChem CID | 143801548 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole |
| SMILES | CN1CNC=C1C#Cc1[nH]nc2ccccc12 |
| InChI | InChI=1S/C13H12N4/c1-17-9-14-8-10(17)6-7-13-11-4-2-3-5-12(11)15-16-13/h2-5,8,14H,9H2,1H3,(H,15,16) |
| InChIKey | LZRQZQAUUMUAKK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole?
The IUPAC name of 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole (CID 143801548) is 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole.
What is the SMILES notation for 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole?
The canonical SMILES for 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole is CN1CNC=C1C#Cc1[nH]nc2ccccc12.
What is the InChIKey of 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole?
The InChIKey is LZRQZQAUUMUAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4/c1-17-9-14-8-10(17)6-7-13-11-4-2-3-5-12(11)15-16-13/h2-5,8,14H,9H2,1H3,(H,15,16).
What are the key properties of 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole?
3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole has a molecular weight of 224.27 g/mol, XLogP of 1.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-methyl-1,2-dihydroimidazol-4-yl)ethynyl]-2H-indazole is sourced from PubChem (CID 143801548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).