C13H11NO4 — CID 143801772
1-hydroxy-3-nitroso-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 143801772) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 1-hydroxy-3-nitroso-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 1-hydroxy-3-nitroso-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 143801772 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-hydroxy-3-nitroso-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | O=Nc1cc(O)c2c3c(c(=O)oc2c1)CCCC3 |
| InChI | InChI=1S/C13H11NO4/c15-10-5-7(14-17)6-11-12(10)8-3-1-2-4-9(8)13(16)18-11/h5-6,15H,1-4H2 |
| InChIKey | BNDXOLRNAYWVFF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|