C16H17NO5 — CID 143801806
8-(aminomethyl)-5-hydroxy-4-propyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione (PubChem CID 143801806) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 8-(aminomethyl)-5-hydroxy-4-propyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione.
| Compound Name | 8-(aminomethyl)-5-hydroxy-4-propyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
|---|---|
| PubChem CID | 143801806 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 8-(aminomethyl)-5-hydroxy-4-propyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
| SMILES | CCCc1cc(=O)oc2c3c(cc(O)c12)OC(CN)CC3=O |
| InChI | InChI=1S/C16H17NO5/c1-2-3-8-4-13(20)22-16-14(8)11(19)6-12-15(16)10(18)5-9(7-17)21-12/h4,6,9,19H,2-3,5,7,17H2,1H3 |
| InChIKey | NTPWVYSEKYLGMO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|