C19H18O5 — CID 143801823
4-[(2E,4Z)-hexa-2,4-dien-2-yl]-5-hydroxy-8-methyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione (PubChem CID 143801823) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-[(2E,4Z)-hexa-2,4-dien-2-yl]-5-hydroxy-8-methyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione.
| Compound Name | 4-[(2E,4Z)-hexa-2,4-dien-2-yl]-5-hydroxy-8-methyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
|---|---|
| PubChem CID | 143801823 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-[(2E,4Z)-hexa-2,4-dien-2-yl]-5-hydroxy-8-methyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
| SMILES | C/C=C\C=C(/C)c1cc(=O)oc2c3c(cc(O)c12)OC(C)CC3=O |
| InChI | InChI=1S/C19H18O5/c1-4-5-6-10(2)12-8-16(22)24-19-17(12)14(21)9-15-18(19)13(20)7-11(3)23-15/h4-6,8-9,11,21H,7H2,1-3H3/b5-4-,10-6+ |
| InChIKey | ICCMHKQCHIBBGH-VWJYOPCBSA-N |
| XLogP | 3.83 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|