About ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate
ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate (PubChem CID 143801911) has the molecular formula C19H35NO4
and a molecular weight of 341.49 g/mol. Its IUPAC name is ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate |
| PubChem CID | 143801911 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate |
| SMILES | CC.CC[C@H]1CCC[C@@H](C)N1C(=O)OC1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C17H29NO4.C2H6/c1-4-14-7-5-6-12(2)18(14)17(20)22-15-10-8-13(9-11-15)16(19)21-3;1-2/h12-15H,4-11H2,1-3H3;1-2H3/t12-,13?,14+,15?;/m1./s1 |
| InChIKey | YMZWKHNSIPCPDJ-CEUYFYNXSA-N |
| XLogP | 4.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate?
The IUPAC name of ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate (CID 143801911) is ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate.
What is the SMILES notation for ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate?
The canonical SMILES for ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate is CC.CC[C@H]1CCC[C@@H](C)N1C(=O)OC1CCC(C(=O)OC)CC1.
What is the InChIKey of ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate?
The InChIKey is YMZWKHNSIPCPDJ-CEUYFYNXSA-N. The full InChI is InChI=1S/C17H29NO4.C2H6/c1-4-14-7-5-6-12(2)18(14)17(20)22-15-10-8-13(9-11-15)16(19)21-3;1-2/h12-15H,4-11H2,1-3H3;1-2H3/t12-,13?,14+,15?;/m1./s1.
What are the key properties of ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate?
ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate has a molecular weight of 341.49 g/mol, XLogP of 4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-methoxycarbonylcyclohexyl) (2S,6R)-2-ethyl-6-methylpiperidine-1-carboxylate is sourced from PubChem (CID 143801911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).