About (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane
(2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane (PubChem CID 143802045) has the molecular formula C12H23N3O3
and a molecular weight of 257.33 g/mol. Its IUPAC name is (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane.
Molecular Properties
| Compound Name | (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane |
| PubChem CID | 143802045 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane |
| SMILES | CC.CNC(=O)[C@H](C(C)C)N(N)C(=O)/C=C\C=O |
| InChI | InChI=1S/C10H17N3O3.C2H6/c1-7(2)9(10(16)12-3)13(11)8(15)5-4-6-14;1-2/h4-7,9H,11H2,1-3H3,(H,12,16);1-2H3/b5-4-;/t9-;/m0./s1 |
| InChIKey | GWYQHOVVWDNTEA-LRGNEQDWSA-N |
| XLogP | 0.24 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane?
The IUPAC name of (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane (CID 143802045) is (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane.
What is the SMILES notation for (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane?
The canonical SMILES for (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane is CC.CNC(=O)[C@H](C(C)C)N(N)C(=O)/C=C\C=O.
What is the InChIKey of (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane?
The InChIKey is GWYQHOVVWDNTEA-LRGNEQDWSA-N. The full InChI is InChI=1S/C10H17N3O3.C2H6/c1-7(2)9(10(16)12-3)13(11)8(15)5-4-6-14;1-2/h4-7,9H,11H2,1-3H3,(H,12,16);1-2H3/b5-4-;/t9-;/m0./s1.
What are the key properties of (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane?
(2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane has a molecular weight of 257.33 g/mol, XLogP of 0.24, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[amino-[(Z)-4-oxobut-2-enoyl]amino]-N,3-dimethylbutanamide;ethane is sourced from PubChem (CID 143802045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).