About methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde
methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde (PubChem CID 143802149) has the molecular formula C10H16NO2S+
and a molecular weight of 214.31 g/mol. Its IUPAC name is methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde.
Molecular Properties
| Compound Name | methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde |
| PubChem CID | 143802149 |
| Molecular Formula | C10H16NO2S+ |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde |
| SMILES | CO.O=Cc1cc[n+](CCCS)cc1 |
| InChI | InChI=1S/C9H11NOS.CH4O/c11-8-9-2-5-10(6-3-9)4-1-7-12;1-2/h2-3,5-6,8H,1,4,7H2;2H,1H3/p+1 |
| InChIKey | KCMQIFFQOHHAPT-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde?
The IUPAC name of methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde (CID 143802149) is methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde.
What is the SMILES notation for methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde?
The canonical SMILES for methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde is CO.O=Cc1cc[n+](CCCS)cc1.
What is the InChIKey of methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde?
The InChIKey is KCMQIFFQOHHAPT-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H11NOS.CH4O/c11-8-9-2-5-10(6-3-9)4-1-7-12;1-2/h2-3,5-6,8H,1,4,7H2;2H,1H3/p+1.
What are the key properties of methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde?
methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde has a molecular weight of 214.31 g/mol, XLogP of 0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;1-(3-sulfanylpropyl)pyridin-1-ium-4-carbaldehyde is sourced from PubChem (CID 143802149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).