C24H35N5O4 — CID 143802320
N-[7-[(ethylcarbamoylamino)methyl]-3-formyl-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]-2-(methylamino)-3-phenylpropanamide (PubChem CID 143802320) has the molecular formula C24H35N5O4 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[7-[(ethylcarbamoylamino)methyl]-3-formyl-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]-2-(methylamino)-3-phenylpropanamide.
| Compound Name | N-[7-[(ethylcarbamoylamino)methyl]-3-formyl-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]-2-(methylamino)-3-phenylpropanamide |
|---|---|
| PubChem CID | 143802320 |
| Molecular Formula | C24H35N5O4 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-[7-[(ethylcarbamoylamino)methyl]-3-formyl-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepin-6-yl]-2-(methylamino)-3-phenylpropanamide |
| SMILES | CCNC(=O)NCC1CCC2CCC(C=O)N2C(=O)C1NC(=O)C(Cc1ccccc1)NC |
| InChI | InChI=1S/C24H35N5O4/c1-3-26-24(33)27-14-17-9-10-18-11-12-19(15-30)29(18)23(32)21(17)28-22(31)20(25-2)13-16-7-5-4-6-8-16/h4-8,15,17-21,25H,3,9-14H2,1-2H3,(H,28,31)(H2,26,27,33) |
| InChIKey | WFXGQMROHZXUJS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|