About 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one
5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one (PubChem CID 143802485) has the molecular formula C20H22O4
and a molecular weight of 326.39 g/mol. Its IUPAC name is 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one.
Molecular Properties
| Compound Name | 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one |
| PubChem CID | 143802485 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one |
| SMILES | CCCc1cc(=O)oc2c(C(C)=O)c(O)c3c(c12)CC(C)(C)C=C3 |
| InChI | InChI=1S/C20H22O4/c1-5-6-12-9-15(22)24-19-16(11(2)21)18(23)13-7-8-20(3,4)10-14(13)17(12)19/h7-9,23H,5-6,10H2,1-4H3 |
| InChIKey | AZXWQPPIKORJCE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one?
The IUPAC name of 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one (CID 143802485) is 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one.
What is the SMILES notation for 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one?
The canonical SMILES for 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one is CCCc1cc(=O)oc2c(C(C)=O)c(O)c3c(c12)CC(C)(C)C=C3.
What is the InChIKey of 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one?
The InChIKey is AZXWQPPIKORJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O4/c1-5-6-12-9-15(22)24-19-16(11(2)21)18(23)13-7-8-20(3,4)10-14(13)17(12)19/h7-9,23H,5-6,10H2,1-4H3.
What are the key properties of 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one?
5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one has a molecular weight of 326.39 g/mol, XLogP of 4.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-6-hydroxy-9,9-dimethyl-1-propyl-10H-benzo[f]chromen-3-one is sourced from PubChem (CID 143802485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).