C20H29N3OS — CID 143802700
N'-ethenylpentane-1,5-diamine;9-methyl-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one (PubChem CID 143802700) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is N'-ethenylpentane-1,5-diamine;9-methyl-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one.
| Compound Name | N'-ethenylpentane-1,5-diamine;9-methyl-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one |
|---|---|
| PubChem CID | 143802700 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N'-ethenylpentane-1,5-diamine;9-methyl-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinolin-5-one |
| SMILES | C=CNCCCCCN.Cc1ccc2[nH]c(=O)c3c(c2c1)CCSC3 |
| InChI | InChI=1S/C13H13NOS.C7H16N2/c1-8-2-3-12-10(6-8)9-4-5-16-7-11(9)13(15)14-12;1-2-9-7-5-3-4-6-8/h2-3,6H,4-5,7H2,1H3,(H,14,15);2,9H,1,3-8H2 |
| InChIKey | GPHBXXNGSBFMSB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|