C14H26N2S — CID 143803006
2,5-bis(3-methylpentan-3-yl)-1,3,4-thiadiazole (PubChem CID 143803006) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 2,5-bis(3-methylpentan-3-yl)-1,3,4-thiadiazole.
| Compound Name | 2,5-bis(3-methylpentan-3-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 143803006 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2,5-bis(3-methylpentan-3-yl)-1,3,4-thiadiazole |
| SMILES | CCC(C)(CC)c1nnc(C(C)(CC)CC)s1 |
| InChI | InChI=1S/C14H26N2S/c1-7-13(5,8-2)11-15-16-12(17-11)14(6,9-3)10-4/h7-10H2,1-6H3 |
| InChIKey | PIHZYNGOTGOXRL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |