C25H22N8OS — CID 143803020
6-(2-hydrazinylethylamino)-2-phenyl-N-[2-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]pyrimidine-4-carboxamide (PubChem CID 143803020) has the molecular formula C25H22N8OS and a molecular weight of 482.57 g/mol. Its IUPAC name is 6-(2-hydrazinylethylamino)-2-phenyl-N-[2-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(2-hydrazinylethylamino)-2-phenyl-N-[2-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143803020 |
| Molecular Formula | C25H22N8OS |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 6-(2-hydrazinylethylamino)-2-phenyl-N-[2-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]pyrimidine-4-carboxamide |
| SMILES | NNCCNc1cc(C(=O)Nc2ccccc2-c2nc3cccnc3s2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H22N8OS/c26-29-14-13-27-21-15-20(30-22(33-21)16-7-2-1-3-8-16)23(34)31-18-10-5-4-9-17(18)24-32-19-11-6-12-28-25(19)35-24/h1-12,15,29H,13-14,26H2,(H,31,34)(H,27,30,33) |
| InChIKey | XFYYJUIGKWSYDD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|