C16H28N2 — CID 143803423
1,5-dimethyl-2H-pyrazine;ethane;(3Z,5Z)-3-methylhepta-1,3,5-triene (PubChem CID 143803423) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1,5-dimethyl-2H-pyrazine;ethane;(3Z,5Z)-3-methylhepta-1,3,5-triene.
| Compound Name | 1,5-dimethyl-2H-pyrazine;ethane;(3Z,5Z)-3-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143803423 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1,5-dimethyl-2H-pyrazine;ethane;(3Z,5Z)-3-methylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C/C.CC.CC1=CN(C)CC=N1 |
| InChI | InChI=1S/C8H12.C6H10N2.C2H6/c1-4-6-7-8(3)5-2;1-6-5-8(2)4-3-7-6;1-2/h4-7H,2H2,1,3H3;3,5H,4H2,1-2H3;1-2H3/b6-4-,8-7-;; |
| InChIKey | CKBQICXSXHRHKH-GTWMBCDHSA-N |
| XLogP | 4.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|