About cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid
cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid (PubChem CID 143803626) has the molecular formula C21H33ClO2S
and a molecular weight of 385.01 g/mol. Its IUPAC name is cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid |
| PubChem CID | 143803626 |
| Molecular Formula | C21H33ClO2S |
| Molecular Weight | 385.01 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid |
| SMILES | C=CCCCCCC[C@H]1CC[C@@H](Cl)C1.CCCc1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C13H23Cl.C8H10O2S/c1-2-3-4-5-6-7-8-12-9-10-13(14)11-12;1-2-3-6-4-5-7(11-6)8(9)10/h2,12-13H,1,3-11H2;4-5H,2-3H2,1H3,(H,9,10)/t12-,13+;/m0./s1 |
| InChIKey | QUFRWUGFPPTSIO-JHEYCYPBSA-N |
| XLogP | 7.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.01 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid?
The IUPAC name of cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid (CID 143803626) is cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid.
What is the SMILES notation for cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid?
The canonical SMILES for cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid is C=CCCCCCC[C@H]1CC[C@@H](Cl)C1.CCCc1ccc(C(=O)O)s1.
What is the InChIKey of cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid?
The InChIKey is QUFRWUGFPPTSIO-JHEYCYPBSA-N. The full InChI is InChI=1S/C13H23Cl.C8H10O2S/c1-2-3-4-5-6-7-8-12-9-10-13(14)11-12;1-2-3-6-4-5-7(11-6)8(9)10/h2,12-13H,1,3-11H2;4-5H,2-3H2,1H3,(H,9,10)/t12-,13+;/m0./s1.
What are the key properties of cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid?
cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid has a molecular weight of 385.01 g/mol, XLogP of 7.32, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-1-chloro-3-oct-7-enylcyclopentane;5-propylthiophene-2-carboxylic acid is sourced from PubChem (CID 143803626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).