About 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol
6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol (PubChem CID 143803770) has the molecular formula C6H5FN2S2
and a molecular weight of 188.25 g/mol. Its IUPAC name is 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol.
Molecular Properties
| Compound Name | 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol |
| PubChem CID | 143803770 |
| Molecular Formula | C6H5FN2S2 |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol |
| SMILES | Cc1cn2c(S)c(F)nc2s1 |
| InChI | InChI=1S/C6H5FN2S2/c1-3-2-9-5(10)4(7)8-6(9)11-3/h2,10H,1H3 |
| InChIKey | IGKMDDSVLVGHDU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 17.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol?
The IUPAC name of 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol (CID 143803770) is 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol.
What is the SMILES notation for 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol?
The canonical SMILES for 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol is Cc1cn2c(S)c(F)nc2s1.
What is the InChIKey of 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol?
The InChIKey is IGKMDDSVLVGHDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FN2S2/c1-3-2-9-5(10)4(7)8-6(9)11-3/h2,10H,1H3.
What are the key properties of 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol?
6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol has a molecular weight of 188.25 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-methylimidazo[2,1-b][1,3]thiazole-5-thiol is sourced from PubChem (CID 143803770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).