C11H26N4 — CID 143804175
N-(3-aminopropyl)-N'-[[ethyl(methyl)amino]methyl]methanimidamide;prop-1-ene (PubChem CID 143804175) has the molecular formula C11H26N4 and a molecular weight of 214.36 g/mol. Its IUPAC name is N-(3-aminopropyl)-N'-[[ethyl(methyl)amino]methyl]methanimidamide;prop-1-ene.
| Compound Name | N-(3-aminopropyl)-N'-[[ethyl(methyl)amino]methyl]methanimidamide;prop-1-ene |
|---|---|
| PubChem CID | 143804175 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | N-(3-aminopropyl)-N'-[[ethyl(methyl)amino]methyl]methanimidamide;prop-1-ene |
| SMILES | C=CC.CCN(C)C/N=C/NCCCN |
| InChI | InChI=1S/C8H20N4.C3H6/c1-3-12(2)8-11-7-10-6-4-5-9;1-3-2/h7H,3-6,8-9H2,1-2H3,(H,10,11);3H,1H2,2H3 |
| InChIKey | GOEXZRRVPRWWCP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|