About 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene
6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene (PubChem CID 143804388) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene |
| PubChem CID | 143804388 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene |
| SMILES | CCc1cc(C)c2c(c1C)CCCO2 |
| InChI | InChI=1S/C13H18O/c1-4-11-8-9(2)13-12(10(11)3)6-5-7-14-13/h8H,4-7H2,1-3H3 |
| InChIKey | YNKJOZPSGSWWJE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene?
The IUPAC name of 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene (CID 143804388) is 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene.
What is the SMILES notation for 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene?
The canonical SMILES for 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene is CCc1cc(C)c2c(c1C)CCCO2.
What is the InChIKey of 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene?
The InChIKey is YNKJOZPSGSWWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-4-11-8-9(2)13-12(10(11)3)6-5-7-14-13/h8H,4-7H2,1-3H3.
What are the key properties of 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene?
6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene has a molecular weight of 190.29 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5,8-dimethyl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 143804388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).