C13H19NOS — CID 143804502
ethane;(2,4,6-trimethylthieno[2,3-b]pyridin-5-yl)methanol (PubChem CID 143804502) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is ethane;(2,4,6-trimethylthieno[2,3-b]pyridin-5-yl)methanol.
| Compound Name | ethane;(2,4,6-trimethylthieno[2,3-b]pyridin-5-yl)methanol |
|---|---|
| PubChem CID | 143804502 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | ethane;(2,4,6-trimethylthieno[2,3-b]pyridin-5-yl)methanol |
| SMILES | CC.Cc1cc2c(C)c(CO)c(C)nc2s1 |
| InChI | InChI=1S/C11H13NOS.C2H6/c1-6-4-9-7(2)10(5-13)8(3)12-11(9)14-6;1-2/h4,13H,5H2,1-3H3;1-2H3 |
| InChIKey | KPHLLBLJNAUIHR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |