About N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine
N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine (PubChem CID 143804723) has the molecular formula C21H28N4S
and a molecular weight of 368.55 g/mol. Its IUPAC name is N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine.
Molecular Properties
| Compound Name | N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine |
| PubChem CID | 143804723 |
| Molecular Formula | C21H28N4S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine |
| SMILES | CNc1ccc2[nH]cc(C3CCCC(NC)C3)c2c1.[H]/N=C/c1cccs1 |
| InChI | InChI=1S/C16H23N3.C5H5NS/c1-17-12-5-3-4-11(8-12)15-10-19-16-7-6-13(18-2)9-14(15)16;6-4-5-2-1-3-7-5/h6-7,9-12,17-19H,3-5,8H2,1-2H3;1-4,6H/b;6-4+ |
| InChIKey | IXFZXQAJIPADRK-DVXCEAISSA-N |
| XLogP | 5.20 |
| TPSA | 63.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine?
The IUPAC name of N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine (CID 143804723) is N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine.
What is the SMILES notation for N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine?
The canonical SMILES for N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine is CNc1ccc2[nH]cc(C3CCCC(NC)C3)c2c1.[H]/N=C/c1cccs1.
What is the InChIKey of N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine?
The InChIKey is IXFZXQAJIPADRK-DVXCEAISSA-N. The full InChI is InChI=1S/C16H23N3.C5H5NS/c1-17-12-5-3-4-11(8-12)15-10-19-16-7-6-13(18-2)9-14(15)16;6-4-5-2-1-3-7-5/h6-7,9-12,17-19H,3-5,8H2,1-2H3;1-4,6H/b;6-4+.
What are the key properties of N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine?
N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine has a molecular weight of 368.55 g/mol, XLogP of 5.20, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-[3-(methylamino)cyclohexyl]-1H-indol-5-amine;thiophen-2-ylmethanimine is sourced from PubChem (CID 143804723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).