About 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol
1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol (PubChem CID 143804832) has the molecular formula C12H11F6NO
and a molecular weight of 299.21 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol |
| PubChem CID | 143804832 |
| Molecular Formula | C12H11F6NO |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol |
| SMILES | C/N=C/CC(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO/c1-19-3-2-10(20)7-4-8(11(13,14)15)6-9(5-7)12(16,17)18/h3-6,10,20H,2H2,1H3/b19-3+ |
| InChIKey | FSSFYPWOGHLBEV-QBROUFQSSA-N |
| XLogP | 3.85 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol (CID 143804832) is 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol is C/N=C/CC(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol?
The InChIKey is FSSFYPWOGHLBEV-QBROUFQSSA-N. The full InChI is InChI=1S/C12H11F6NO/c1-19-3-2-10(20)7-4-8(11(13,14)15)6-9(5-7)12(16,17)18/h3-6,10,20H,2H2,1H3/b19-3+.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol?
1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol has a molecular weight of 299.21 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-3-methyliminopropan-1-ol is sourced from PubChem (CID 143804832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).