C23H27N3O2S — CID 143804868
S-[2-[2-(3-methoxyphenyl)-1-(2-methylpropyl)benzimidazol-5-yl]prop-2-enyl] N-methylcarbamothioate (PubChem CID 143804868) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is S-[2-[2-(3-methoxyphenyl)-1-(2-methylpropyl)benzimidazol-5-yl]prop-2-enyl] N-methylcarbamothioate.
| Compound Name | S-[2-[2-(3-methoxyphenyl)-1-(2-methylpropyl)benzimidazol-5-yl]prop-2-enyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 143804868 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | S-[2-[2-(3-methoxyphenyl)-1-(2-methylpropyl)benzimidazol-5-yl]prop-2-enyl] N-methylcarbamothioate |
| SMILES | C=C(CSC(=O)NC)c1ccc2c(c1)nc(-c1cccc(OC)c1)n2CC(C)C |
| InChI | InChI=1S/C23H27N3O2S/c1-15(2)13-26-21-10-9-17(16(3)14-29-23(27)24-4)12-20(21)25-22(26)18-7-6-8-19(11-18)28-5/h6-12,15H,3,13-14H2,1-2,4-5H3,(H,24,27) |
| InChIKey | LZJQYWUWVNSLRT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|