C26H35F3N2 — CID 143804964
(11R)-11-methyl-2-[2-(1-methylcyclohexyl)ethyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole (PubChem CID 143804964) has the molecular formula C26H35F3N2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (11R)-11-methyl-2-[2-(1-methylcyclohexyl)ethyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole.
| Compound Name | (11R)-11-methyl-2-[2-(1-methylcyclohexyl)ethyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 143804964 |
| Molecular Formula | C26H35F3N2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | (11R)-11-methyl-2-[2-(1-methylcyclohexyl)ethyl]-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazole |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)CC2CCN(CCC3(C)CCCCC3)CC21 |
| InChI | InChI=1S/C26H35F3N2/c1-17-21-16-31(13-11-25(2)9-4-3-5-10-25)12-8-18(21)14-23-24(17)20-15-19(26(27,28)29)6-7-22(20)30-23/h6-7,15,17-18,21,30H,3-5,8-14,16H2,1-2H3/t17-,18?,21?/m1/s1 |
| InChIKey | OHDRQQGIANHXRM-MPQSDHOMSA-N |
| XLogP | 7.14 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|