C16H21N3 — CID 143805171
5,6-bis(ethenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-4-amine;ethane (PubChem CID 143805171) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-4-amine;ethane.
| Compound Name | 5,6-bis(ethenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 143805171 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 5,6-bis(ethenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidin-4-amine;ethane |
| SMILES | C=C/C=C(\C=C)Nc1ncnc(C=C)c1C=C.CC |
| InChI | InChI=1S/C14H15N3.C2H6/c1-5-9-11(6-2)17-14-12(7-3)13(8-4)15-10-16-14;1-2/h5-10H,1-4H2,(H,15,16,17);1-2H3/b11-9+; |
| InChIKey | XGDMYKXBOFNERG-LBEJWNQZSA-N |
| XLogP | 4.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|