About 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole
5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole (PubChem CID 143805380) has the molecular formula C24H25N3
and a molecular weight of 355.49 g/mol. Its IUPAC name is 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole.
Molecular Properties
| Compound Name | 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole |
| PubChem CID | 143805380 |
| Molecular Formula | C24H25N3 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole |
| SMILES | CCc1ccc(Cc2cccc(Cc3ccc4[nH]ncc4c3)n2)cc1CC |
| InChI | InChI=1S/C24H25N3/c1-3-19-10-8-17(12-20(19)4-2)14-22-6-5-7-23(26-22)15-18-9-11-24-21(13-18)16-25-27-24/h5-13,16H,3-4,14-15H2,1-2H3,(H,25,27) |
| InChIKey | ZOFBXLDWYSHZIB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole?
The IUPAC name of 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole (CID 143805380) is 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole.
What is the SMILES notation for 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole?
The canonical SMILES for 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole is CCc1ccc(Cc2cccc(Cc3ccc4[nH]ncc4c3)n2)cc1CC.
What is the InChIKey of 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole?
The InChIKey is ZOFBXLDWYSHZIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3/c1-3-19-10-8-17(12-20(19)4-2)14-22-6-5-7-23(26-22)15-18-9-11-24-21(13-18)16-25-27-24/h5-13,16H,3-4,14-15H2,1-2H3,(H,25,27).
What are the key properties of 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole?
5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole has a molecular weight of 355.49 g/mol, XLogP of 5.26, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[6-[(3,4-diethylphenyl)methyl]-2-pyridinyl]methyl]-1H-indazole is sourced from PubChem (CID 143805380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).