About 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone
1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone (PubChem CID 143806526) has the molecular formula C22H25Cl2NO2
and a molecular weight of 406.35 g/mol. Its IUPAC name is 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone.
Molecular Properties
| Compound Name | 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone |
| PubChem CID | 143806526 |
| Molecular Formula | C22H25Cl2NO2 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone |
| SMILES | CCC1CCN(C(=O)C(OC)c2ccccc2)C[C@@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2NO2/c1-3-15-11-12-25(14-18(15)17-9-10-19(23)20(24)13-17)22(26)21(27-2)16-7-5-4-6-8-16/h4-10,13,15,18,21H,3,11-12,14H2,1-2H3/t15?,18-,21?/m0/s1 |
| InChIKey | UMFYCSFEDSGPKO-GFBDMGBSSA-N |
| XLogP | 5.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone?
The IUPAC name of 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone (CID 143806526) is 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone.
What is the SMILES notation for 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone?
The canonical SMILES for 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone is CCC1CCN(C(=O)C(OC)c2ccccc2)C[C@@H]1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone?
The InChIKey is UMFYCSFEDSGPKO-GFBDMGBSSA-N. The full InChI is InChI=1S/C22H25Cl2NO2/c1-3-15-11-12-25(14-18(15)17-9-10-19(23)20(24)13-17)22(26)21(27-2)16-7-5-4-6-8-16/h4-10,13,15,18,21H,3,11-12,14H2,1-2H3/t15?,18-,21?/m0/s1.
What are the key properties of 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone?
1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone has a molecular weight of 406.35 g/mol, XLogP of 5.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3-(3,4-dichlorophenyl)-4-ethylpiperidin-1-yl]-2-methoxy-2-phenylethanone is sourced from PubChem (CID 143806526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).