About ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene
ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene (PubChem CID 143806673) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene |
| PubChem CID | 143806673 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene |
| SMILES | CC.CCOCCCCCCCCC1=C(C)CCC(OC)=C1 |
| InChI | InChI=1S/C18H32O2.C2H6/c1-4-20-14-10-8-6-5-7-9-11-17-15-18(19-3)13-12-16(17)2;1-2/h15H,4-14H2,1-3H3;1-2H3 |
| InChIKey | GQCZGALTFHUYSI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene?
The IUPAC name of ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene (CID 143806673) is ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene.
What is the SMILES notation for ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene?
The canonical SMILES for ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene is CC.CCOCCCCCCCCC1=C(C)CCC(OC)=C1.
What is the InChIKey of ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene?
The InChIKey is GQCZGALTFHUYSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O2.C2H6/c1-4-20-14-10-8-6-5-7-9-11-17-15-18(19-3)13-12-16(17)2;1-2/h15H,4-14H2,1-3H3;1-2H3.
What are the key properties of ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene?
ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene has a molecular weight of 310.52 g/mol, XLogP of 6.42, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(8-ethoxyoctyl)-4-methoxy-1-methylcyclohexa-1,3-diene is sourced from PubChem (CID 143806673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).